C6H10N2O2 — CID 82594349
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]hydroxylamine (PubChem CID 82594349) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]hydroxylamine.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 82594349 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]hydroxylamine |
| SMILES | Cc1nc(CNO)oc1C |
| InChI | InChI=1S/C6H10N2O2/c1-4-5(2)10-6(8-4)3-7-9/h7,9H,3H2,1-2H3 |
| InChIKey | ZQHFVSBGCQPHBS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|