C7H9N3O — CID 106371953
(4,5-dimethyl-1,3-oxazol-2-yl)methylcyanamide (PubChem CID 106371953) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is (4,5-dimethyl-1,3-oxazol-2-yl)methylcyanamide.
| Compound Name | (4,5-dimethyl-1,3-oxazol-2-yl)methylcyanamide |
|---|---|
| PubChem CID | 106371953 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | (4,5-dimethyl-1,3-oxazol-2-yl)methylcyanamide |
| SMILES | Cc1nc(CNC#N)oc1C |
| InChI | InChI=1S/C7H9N3O/c1-5-6(2)11-7(10-5)3-9-4-8/h9H,3H2,1-2H3 |
| InChIKey | RBOCJOOOPGDWPG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|