C11H9F4N3O — CID 113254675
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 113254675) has the molecular formula C11H9F4N3O and a molecular weight of 275.20 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 113254675 |
| Molecular Formula | C11H9F4N3O |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | Cc1nc(CNc2c(F)c(F)nc(F)c2F)oc1C |
| InChI | InChI=1S/C11H9F4N3O/c1-4-5(2)19-6(17-4)3-16-9-7(12)10(14)18-11(15)8(9)13/h3H2,1-2H3,(H,16,18) |
| InChIKey | QFROZGWSQNBQSA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|