C13H14N4O — CID 106369993
4-amino-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]benzonitrile (PubChem CID 106369993) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-amino-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]benzonitrile.
| Compound Name | 4-amino-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 106369993 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-amino-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]benzonitrile |
| SMILES | Cc1nc(CNc2cc(C#N)ccc2N)oc1C |
| InChI | InChI=1S/C13H14N4O/c1-8-9(2)18-13(17-8)7-16-12-5-10(6-14)3-4-11(12)15/h3-5,16H,7,15H2,1-2H3 |
| InChIKey | UHWPOTXFSYUQLP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|