C12H14IN3O — CID 106369876
1-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-iodobenzene-1,4-diamine (PubChem CID 106369876) has the molecular formula C12H14IN3O and a molecular weight of 343.17 g/mol. Its IUPAC name is 1-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-iodobenzene-1,4-diamine.
| Compound Name | 1-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-iodobenzene-1,4-diamine |
|---|---|
| PubChem CID | 106369876 |
| Molecular Formula | C12H14IN3O |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 1-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-iodobenzene-1,4-diamine |
| SMILES | Cc1nc(CNc2ccc(N)cc2I)oc1C |
| InChI | InChI=1S/C12H14IN3O/c1-7-8(2)17-12(16-7)6-15-11-4-3-9(14)5-10(11)13/h3-5,15H,6,14H2,1-2H3 |
| InChIKey | GOHGINGVXXZSQP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|