C11H19N3O2 — CID 103752681
1-tert-butyl-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]urea (PubChem CID 103752681) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-tert-butyl-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]urea.
| Compound Name | 1-tert-butyl-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 103752681 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-tert-butyl-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]urea |
| SMILES | Cc1nc(CNC(=O)NC(C)(C)C)oc1C |
| InChI | InChI=1S/C11H19N3O2/c1-7-8(2)16-9(13-7)6-12-10(15)14-11(3,4)5/h6H2,1-5H3,(H2,12,14,15) |
| InChIKey | WHKIHDAOKJKQCS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |