C11H17F3N2O — CID 113327418
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 113327418) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 113327418 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | Cc1nc(CNCCCCC(F)(F)F)oc1C |
| InChI | InChI=1S/C11H17F3N2O/c1-8-9(2)17-10(16-8)7-15-6-4-3-5-11(12,13)14/h15H,3-7H2,1-2H3 |
| InChIKey | YOJZOGUGSXTYHA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|