About 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine
5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine (PubChem CID 103604912) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine |
| PubChem CID | 103604912 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine |
| SMILES | Cc1nnc(CNC(C)CCC(C)C)o1 |
| InChI | InChI=1S/C11H21N3O/c1-8(2)5-6-9(3)12-7-11-14-13-10(4)15-11/h8-9,12H,5-7H2,1-4H3 |
| InChIKey | HFFTWEWRVXXUJI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine?
The IUPAC name of 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine (CID 103604912) is 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine.
What is the SMILES notation for 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine?
The canonical SMILES for 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine is Cc1nnc(CNC(C)CCC(C)C)o1.
What is the InChIKey of 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine?
The InChIKey is HFFTWEWRVXXUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-8(2)5-6-9(3)12-7-11-14-13-10(4)15-11/h8-9,12H,5-7H2,1-4H3.
What are the key properties of 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine?
5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine has a molecular weight of 211.31 g/mol, XLogP of 2.29, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]hexan-2-amine is sourced from PubChem (CID 103604912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).