C12H23N3O — CID 103605015
N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]octan-2-amine (PubChem CID 103605015) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]octan-2-amine.
| Compound Name | N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]octan-2-amine |
|---|---|
| PubChem CID | 103605015 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]octan-2-amine |
| SMILES | CCCCCCC(C)NCc1nnc(C)o1 |
| InChI | InChI=1S/C12H23N3O/c1-4-5-6-7-8-10(2)13-9-12-15-14-11(3)16-12/h10,13H,4-9H2,1-3H3 |
| InChIKey | OUQOWDDMWQQVTI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|