C11H20N2O — CID 103096842
N-[(5-methyl-1,3-oxazol-2-yl)methyl]hexan-2-amine (PubChem CID 103096842) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N-[(5-methyl-1,3-oxazol-2-yl)methyl]hexan-2-amine.
| Compound Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]hexan-2-amine |
|---|---|
| PubChem CID | 103096842 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]hexan-2-amine |
| SMILES | CCCCC(C)NCc1ncc(C)o1 |
| InChI | InChI=1S/C11H20N2O/c1-4-5-6-9(2)12-8-11-13-7-10(3)14-11/h7,9,12H,4-6,8H2,1-3H3 |
| InChIKey | KXPIHFMGYDXNON-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |