About 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol
3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol (PubChem CID 107914968) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol.
Molecular Properties
| Compound Name | 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol |
| PubChem CID | 107914968 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol |
| SMILES | Cc1nnc(CNC(CO)C(C)C)o1 |
| InChI | InChI=1S/C9H17N3O2/c1-6(2)8(5-13)10-4-9-12-11-7(3)14-9/h6,8,10,13H,4-5H2,1-3H3 |
| InChIKey | FIGGHXXCZQEJNE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol?
The IUPAC name of 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol (CID 107914968) is 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol.
What is the SMILES notation for 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol?
The canonical SMILES for 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol is Cc1nnc(CNC(CO)C(C)C)o1.
What is the InChIKey of 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol?
The InChIKey is FIGGHXXCZQEJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2/c1-6(2)8(5-13)10-4-9-12-11-7(3)14-9/h6,8,10,13H,4-5H2,1-3H3.
What are the key properties of 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol?
3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol has a molecular weight of 199.25 g/mol, XLogP of 0.48, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methylamino]butan-1-ol is sourced from PubChem (CID 107914968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).