C12H15N3O — CID 106372261
N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-pyridin-4-ylethanamine (PubChem CID 106372261) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-pyridin-4-ylethanamine.
| Compound Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-pyridin-4-ylethanamine |
|---|---|
| PubChem CID | 106372261 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-pyridin-4-ylethanamine |
| SMILES | Cc1cnc(CNCCc2ccncc2)o1 |
| InChI | InChI=1S/C12H15N3O/c1-10-8-15-12(16-10)9-14-7-4-11-2-5-13-6-3-11/h2-3,5-6,8,14H,4,7,9H2,1H3 |
| InChIKey | MKFBJFVCDSEJJC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|