C14H18N2OS — CID 106380017
4-[(1-phenylbutylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106380017) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-[(1-phenylbutylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(1-phenylbutylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106380017 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-[(1-phenylbutylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCCC(NCc1csc(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C14H18N2OS/c1-2-6-13(11-7-4-3-5-8-11)15-9-12-10-18-14(17)16-12/h3-5,7-8,10,13,15H,2,6,9H2,1H3,(H,16,17) |
| InChIKey | LYNHSUWFHMPDDL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |