C12H14N2OS — CID 81462911
4-[2-(methylamino)-2-phenylethyl]-3H-1,3-thiazol-2-one (PubChem CID 81462911) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-[2-(methylamino)-2-phenylethyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[2-(methylamino)-2-phenylethyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 81462911 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-[2-(methylamino)-2-phenylethyl]-3H-1,3-thiazol-2-one |
| SMILES | CNC(Cc1csc(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C12H14N2OS/c1-13-11(9-5-3-2-4-6-9)7-10-8-16-12(15)14-10/h2-6,8,11,13H,7H2,1H3,(H,14,15) |
| InChIKey | QKFBMYKRSUPIFJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |