C15H16BrN — CID 60820242
2-(2-bromophenyl)-N-methyl-1-phenylethanamine (PubChem CID 60820242) has the molecular formula C15H16BrN and a molecular weight of 290.20 g/mol. Its IUPAC name is 2-(2-bromophenyl)-N-methyl-1-phenylethanamine.
| Compound Name | 2-(2-bromophenyl)-N-methyl-1-phenylethanamine |
|---|---|
| PubChem CID | 60820242 |
| Molecular Formula | C15H16BrN |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-(2-bromophenyl)-N-methyl-1-phenylethanamine |
| SMILES | CNC(Cc1ccccc1Br)c1ccccc1 |
| InChI | InChI=1S/C15H16BrN/c1-17-15(12-7-3-2-4-8-12)11-13-9-5-6-10-14(13)16/h2-10,15,17H,11H2,1H3 |
| InChIKey | MXLYUQCULIGJNX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |