C13H14BrN3 — CID 62829674
2-(2-bromophenyl)-N-methyl-1-pyrimidin-5-ylethanamine (PubChem CID 62829674) has the molecular formula C13H14BrN3 and a molecular weight of 292.18 g/mol. Its IUPAC name is 2-(2-bromophenyl)-N-methyl-1-pyrimidin-5-ylethanamine.
| Compound Name | 2-(2-bromophenyl)-N-methyl-1-pyrimidin-5-ylethanamine |
|---|---|
| PubChem CID | 62829674 |
| Molecular Formula | C13H14BrN3 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-(2-bromophenyl)-N-methyl-1-pyrimidin-5-ylethanamine |
| SMILES | CNC(Cc1ccccc1Br)c1cncnc1 |
| InChI | InChI=1S/C13H14BrN3/c1-15-13(11-7-16-9-17-8-11)6-10-4-2-3-5-12(10)14/h2-5,7-9,13,15H,6H2,1H3 |
| InChIKey | GBSJFZBNBXRWOP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |