C6H11N3O3S2 — CID 106380607
2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]ethanesulfonamide (PubChem CID 106380607) has the molecular formula C6H11N3O3S2 and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]ethanesulfonamide.
| Compound Name | 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 106380607 |
| Molecular Formula | C6H11N3O3S2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C6H11N3O3S2/c7-14(11,12)2-1-8-3-5-4-13-6(10)9-5/h4,8H,1-3H2,(H,9,10)(H2,7,11,12) |
| InChIKey | XGNBDQJPHUUHGX-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|