C9H15N3O4S — CID 79415869
methyl 5-[(2-sulfamoylethylamino)methyl]-1H-pyrrole-2-carboxylate (PubChem CID 79415869) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is methyl 5-[(2-sulfamoylethylamino)methyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 5-[(2-sulfamoylethylamino)methyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 79415869 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | methyl 5-[(2-sulfamoylethylamino)methyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNCCS(N)(=O)=O)[nH]1 |
| InChI | InChI=1S/C9H15N3O4S/c1-16-9(13)8-3-2-7(12-8)6-11-4-5-17(10,14)15/h2-3,11-12H,4-6H2,1H3,(H2,10,14,15) |
| InChIKey | MEZOHOKKYFAQEY-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|