C7H8ClNO4S — CID 87285870
methyl 5-(chlorosulfonylmethyl)-1H-pyrrole-2-carboxylate (PubChem CID 87285870) has the molecular formula C7H8ClNO4S and a molecular weight of 237.66 g/mol. Its IUPAC name is methyl 5-(chlorosulfonylmethyl)-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 5-(chlorosulfonylmethyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 87285870 |
| Molecular Formula | C7H8ClNO4S |
| Molecular Weight | 237.66 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | methyl 5-(chlorosulfonylmethyl)-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)Cl)[nH]1 |
| InChI | InChI=1S/C7H8ClNO4S/c1-13-7(10)6-3-2-5(9-6)4-14(8,11)12/h2-3,9H,4H2,1H3 |
| InChIKey | QQAPHILLLYDUPD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.66 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |