C11H13N3O2 — CID 79415396
methyl 5-[(pyrrol-1-ylamino)methyl]-1H-pyrrole-2-carboxylate (PubChem CID 79415396) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is methyl 5-[(pyrrol-1-ylamino)methyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 5-[(pyrrol-1-ylamino)methyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 79415396 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | methyl 5-[(pyrrol-1-ylamino)methyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNn2cccc2)[nH]1 |
| InChI | InChI=1S/C11H13N3O2/c1-16-11(15)10-5-4-9(13-10)8-12-14-6-2-3-7-14/h2-7,12-13H,8H2,1H3 |
| InChIKey | NMLNBEJGKCCEMW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |