C6H9ClN2O3S2 — CID 106383148
2-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide (PubChem CID 106383148) has the molecular formula C6H9ClN2O3S2 and a molecular weight of 256.74 g/mol. Its IUPAC name is 2-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 106383148 |
| Molecular Formula | C6H9ClN2O3S2 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 2-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide |
| SMILES | O=c1[nH]c(CNS(=O)(=O)CCCl)cs1 |
| InChI | InChI=1S/C6H9ClN2O3S2/c7-1-2-14(11,12)8-3-5-4-13-6(10)9-5/h4,8H,1-3H2,(H,9,10) |
| InChIKey | GVQKUAVQKYJXPZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|