C12H15N3O4S2 — CID 106379250
2-(3-aminophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide (PubChem CID 106379250) has the molecular formula C12H15N3O4S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(3-aminophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide.
| Compound Name | 2-(3-aminophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 106379250 |
| Molecular Formula | C12H15N3O4S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-(3-aminophenoxy)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]ethanesulfonamide |
| SMILES | Nc1cccc(OCCS(=O)(=O)NCc2csc(=O)[nH]2)c1 |
| InChI | InChI=1S/C12H15N3O4S2/c13-9-2-1-3-11(6-9)19-4-5-21(17,18)14-7-10-8-20-12(16)15-10/h1-3,6,8,14H,4-5,7,13H2,(H,15,16) |
| InChIKey | NTRWBXJMFIIMNJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|