C10H12N4O3S2 — CID 114911711
2-(3-aminophenoxy)-N-(thiadiazol-5-yl)ethanesulfonamide (PubChem CID 114911711) has the molecular formula C10H12N4O3S2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-(3-aminophenoxy)-N-(thiadiazol-5-yl)ethanesulfonamide.
| Compound Name | 2-(3-aminophenoxy)-N-(thiadiazol-5-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 114911711 |
| Molecular Formula | C10H12N4O3S2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-(3-aminophenoxy)-N-(thiadiazol-5-yl)ethanesulfonamide |
| SMILES | Nc1cccc(OCCS(=O)(=O)Nc2cnns2)c1 |
| InChI | InChI=1S/C10H12N4O3S2/c11-8-2-1-3-9(6-8)17-4-5-19(15,16)13-10-7-12-14-18-10/h1-3,6-7,13H,4-5,11H2 |
| InChIKey | MEPMMRTZVNMDCZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|