C12H15N3O5S — CID 66085634
4-[2-(3-aminophenoxy)ethylsulfonyl]piperazine-2,6-dione (PubChem CID 66085634) has the molecular formula C12H15N3O5S and a molecular weight of 313.33 g/mol. Its IUPAC name is 4-[2-(3-aminophenoxy)ethylsulfonyl]piperazine-2,6-dione.
| Compound Name | 4-[2-(3-aminophenoxy)ethylsulfonyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66085634 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-[2-(3-aminophenoxy)ethylsulfonyl]piperazine-2,6-dione |
| SMILES | Nc1cccc(OCCS(=O)(=O)N2CC(=O)NC(=O)C2)c1 |
| InChI | InChI=1S/C12H15N3O5S/c13-9-2-1-3-10(6-9)20-4-5-21(18,19)15-7-11(16)14-12(17)8-15/h1-3,6H,4-5,7-8,13H2,(H,14,16,17) |
| InChIKey | OYKGKWJDTQWUDT-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|