C20H22N2O6S — CID 5337885
1-(2-phenoxyethyl)-4-(2-phenoxyethylsulfonyl)piperazine-2,6-dione (PubChem CID 5337885) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is 1-(2-phenoxyethyl)-4-(2-phenoxyethylsulfonyl)piperazine-2,6-dione.
| Compound Name | 1-(2-phenoxyethyl)-4-(2-phenoxyethylsulfonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 5337885 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-(2-phenoxyethyl)-4-(2-phenoxyethylsulfonyl)piperazine-2,6-dione |
| SMILES | O=C1CN(S(=O)(=O)CCOc2ccccc2)CC(=O)N1CCOc1ccccc1 |
| InChI | InChI=1S/C20H22N2O6S/c23-19-15-21(29(25,26)14-13-28-18-9-5-2-6-10-18)16-20(24)22(19)11-12-27-17-7-3-1-4-8-17/h1-10H,11-16H2 |
| InChIKey | FPASLRDJYSUWCZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|