C19H23NO3S2 — CID 90629665
4-(2-phenoxyethylsulfonyl)-7-phenyl-1,4-thiazepane (PubChem CID 90629665) has the molecular formula C19H23NO3S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-(2-phenoxyethylsulfonyl)-7-phenyl-1,4-thiazepane.
| Compound Name | 4-(2-phenoxyethylsulfonyl)-7-phenyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90629665 |
| Molecular Formula | C19H23NO3S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 4-(2-phenoxyethylsulfonyl)-7-phenyl-1,4-thiazepane |
| SMILES | O=S(=O)(CCOc1ccccc1)N1CCSC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H23NO3S2/c21-25(22,16-14-23-18-9-5-2-6-10-18)20-12-11-19(24-15-13-20)17-7-3-1-4-8-17/h1-10,19H,11-16H2 |
| InChIKey | INOZQCVOXQSLFV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |