C18H20ClNO5S2 — CID 71806043
3-(4-chlorophenyl)sulfonyl-1-(2-phenoxyethylsulfonyl)pyrrolidine (PubChem CID 71806043) has the molecular formula C18H20ClNO5S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-1-(2-phenoxyethylsulfonyl)pyrrolidine.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-1-(2-phenoxyethylsulfonyl)pyrrolidine |
|---|---|
| PubChem CID | 71806043 |
| Molecular Formula | C18H20ClNO5S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-1-(2-phenoxyethylsulfonyl)pyrrolidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C1CCN(S(=O)(=O)CCOc2ccccc2)C1 |
| InChI | InChI=1S/C18H20ClNO5S2/c19-15-6-8-17(9-7-15)27(23,24)18-10-11-20(14-18)26(21,22)13-12-25-16-4-2-1-3-5-16/h1-9,18H,10-14H2 |
| InChIKey | JUAQJBFGZFPECM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |