C17H16ClF2NO4S2 — CID 90587931
3-(4-chlorophenyl)sulfonyl-1-[(3,5-difluorophenyl)methylsulfonyl]pyrrolidine (PubChem CID 90587931) has the molecular formula C17H16ClF2NO4S2 and a molecular weight of 435.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-1-[(3,5-difluorophenyl)methylsulfonyl]pyrrolidine.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-1-[(3,5-difluorophenyl)methylsulfonyl]pyrrolidine |
|---|---|
| PubChem CID | 90587931 |
| Molecular Formula | C17H16ClF2NO4S2 |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-1-[(3,5-difluorophenyl)methylsulfonyl]pyrrolidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C1CCN(S(=O)(=O)Cc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C17H16ClF2NO4S2/c18-13-1-3-16(4-2-13)27(24,25)17-5-6-21(10-17)26(22,23)11-12-7-14(19)9-15(20)8-12/h1-4,7-9,17H,5-6,10-11H2 |
| InChIKey | PSYAPXSFFRULJP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |