C18H21NO4S2 — CID 90584961
3-(benzenesulfonyl)-1-[(3-methylphenyl)methylsulfonyl]pyrrolidine (PubChem CID 90584961) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-[(3-methylphenyl)methylsulfonyl]pyrrolidine.
| Compound Name | 3-(benzenesulfonyl)-1-[(3-methylphenyl)methylsulfonyl]pyrrolidine |
|---|---|
| PubChem CID | 90584961 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-(benzenesulfonyl)-1-[(3-methylphenyl)methylsulfonyl]pyrrolidine |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCC(S(=O)(=O)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C18H21NO4S2/c1-15-6-5-7-16(12-15)14-24(20,21)19-11-10-18(13-19)25(22,23)17-8-3-2-4-9-17/h2-9,12,18H,10-11,13-14H2,1H3 |
| InChIKey | PNHIMUZSRIZQDQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |