C17H18FNO4S2 — CID 71805609
3-(benzenesulfonyl)-1-[(3-fluorophenyl)methylsulfonyl]pyrrolidine (PubChem CID 71805609) has the molecular formula C17H18FNO4S2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-[(3-fluorophenyl)methylsulfonyl]pyrrolidine.
| Compound Name | 3-(benzenesulfonyl)-1-[(3-fluorophenyl)methylsulfonyl]pyrrolidine |
|---|---|
| PubChem CID | 71805609 |
| Molecular Formula | C17H18FNO4S2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-(benzenesulfonyl)-1-[(3-fluorophenyl)methylsulfonyl]pyrrolidine |
| SMILES | O=S(=O)(c1ccccc1)C1CCN(S(=O)(=O)Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H18FNO4S2/c18-15-6-4-5-14(11-15)13-24(20,21)19-10-9-17(12-19)25(22,23)16-7-2-1-3-8-16/h1-8,11,17H,9-10,12-13H2 |
| InChIKey | NAUZKRVBEGELQK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |