C20H25FN2O2S — CID 110413546
1-benzylsulfonyl-4-[3-(3-fluorophenyl)propyl]piperazine (PubChem CID 110413546) has the molecular formula C20H25FN2O2S and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-[3-(3-fluorophenyl)propyl]piperazine.
| Compound Name | 1-benzylsulfonyl-4-[3-(3-fluorophenyl)propyl]piperazine |
|---|---|
| PubChem CID | 110413546 |
| Molecular Formula | C20H25FN2O2S |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-benzylsulfonyl-4-[3-(3-fluorophenyl)propyl]piperazine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCN(CCCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H25FN2O2S/c21-20-10-4-8-18(16-20)9-5-11-22-12-14-23(15-13-22)26(24,25)17-19-6-2-1-3-7-19/h1-4,6-8,10,16H,5,9,11-15,17H2 |
| InChIKey | GJEMNIVIGPRPIW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |