C22H25FN4O2S — CID 90560937
1-[(3-fluorophenyl)methylsulfonyl]-4-[2-(2-phenylimidazol-1-yl)ethyl]piperazine (PubChem CID 90560937) has the molecular formula C22H25FN4O2S and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methylsulfonyl]-4-[2-(2-phenylimidazol-1-yl)ethyl]piperazine.
| Compound Name | 1-[(3-fluorophenyl)methylsulfonyl]-4-[2-(2-phenylimidazol-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 90560937 |
| Molecular Formula | C22H25FN4O2S |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 1-[(3-fluorophenyl)methylsulfonyl]-4-[2-(2-phenylimidazol-1-yl)ethyl]piperazine |
| SMILES | O=S(=O)(Cc1cccc(F)c1)N1CCN(CCn2ccnc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25FN4O2S/c23-21-8-4-5-19(17-21)18-30(28,29)27-15-12-25(13-16-27)11-14-26-10-9-24-22(26)20-6-2-1-3-7-20/h1-10,17H,11-16,18H2 |
| InChIKey | UZFBDVLKFHVHDM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |