C17H23FN4O2S — CID 90534098
1-[(4-fluorophenyl)methylsulfonyl]-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine (PubChem CID 90534098) has the molecular formula C17H23FN4O2S and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methylsulfonyl]-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine.
| Compound Name | 1-[(4-fluorophenyl)methylsulfonyl]-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 90534098 |
| Molecular Formula | C17H23FN4O2S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[(4-fluorophenyl)methylsulfonyl]-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine |
| SMILES | Cc1nccn1CCN1CCN(S(=O)(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H23FN4O2S/c1-15-19-6-7-21(15)11-8-20-9-12-22(13-10-20)25(23,24)14-16-2-4-17(18)5-3-16/h2-7H,8-14H2,1H3 |
| InChIKey | TXYDVARPDFPQCF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |