C18H25FN4O2S — CID 90561951
1-[2-(2-ethylimidazol-1-yl)ethyl]-4-[(4-fluorophenyl)methylsulfonyl]piperazine (PubChem CID 90561951) has the molecular formula C18H25FN4O2S and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[2-(2-ethylimidazol-1-yl)ethyl]-4-[(4-fluorophenyl)methylsulfonyl]piperazine.
| Compound Name | 1-[2-(2-ethylimidazol-1-yl)ethyl]-4-[(4-fluorophenyl)methylsulfonyl]piperazine |
|---|---|
| PubChem CID | 90561951 |
| Molecular Formula | C18H25FN4O2S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-[2-(2-ethylimidazol-1-yl)ethyl]-4-[(4-fluorophenyl)methylsulfonyl]piperazine |
| SMILES | CCc1nccn1CCN1CCN(S(=O)(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H25FN4O2S/c1-2-18-20-7-8-22(18)12-9-21-10-13-23(14-11-21)26(24,25)15-16-3-5-17(19)6-4-16/h3-8H,2,9-15H2,1H3 |
| InChIKey | UZEFXNBQNZPKMM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |