C17H26N4O2S2 — CID 90561924
1-[2-(2-ethylimidazol-1-yl)ethyl]-4-(5-ethylthiophen-2-yl)sulfonylpiperazine (PubChem CID 90561924) has the molecular formula C17H26N4O2S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is 1-[2-(2-ethylimidazol-1-yl)ethyl]-4-(5-ethylthiophen-2-yl)sulfonylpiperazine.
| Compound Name | 1-[2-(2-ethylimidazol-1-yl)ethyl]-4-(5-ethylthiophen-2-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 90561924 |
| Molecular Formula | C17H26N4O2S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[2-(2-ethylimidazol-1-yl)ethyl]-4-(5-ethylthiophen-2-yl)sulfonylpiperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(CCn3ccnc3CC)CC2)s1 |
| InChI | InChI=1S/C17H26N4O2S2/c1-3-15-5-6-17(24-15)25(22,23)21-13-10-19(11-14-21)9-12-20-8-7-18-16(20)4-2/h5-8H,3-4,9-14H2,1-2H3 |
| InChIKey | RGFUFXKONDNLDO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |