C16H21N3O2S2 — CID 113074210
1-(5-ethylthiophen-2-yl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine (PubChem CID 113074210) has the molecular formula C16H21N3O2S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 113074210 |
| Molecular Formula | C16H21N3O2S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(Cc3ccncc3)CC2)s1 |
| InChI | InChI=1S/C16H21N3O2S2/c1-2-15-3-4-16(22-15)23(20,21)19-11-9-18(10-12-19)13-14-5-7-17-8-6-14/h3-8H,2,9-13H2,1H3 |
| InChIKey | DIDNZTUSUFZMKG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |