C19H26N2O3S2 — CID 113074376
1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(4-methoxyphenyl)ethyl]piperazine (PubChem CID 113074376) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(4-methoxyphenyl)ethyl]piperazine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(4-methoxyphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 113074376 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(4-methoxyphenyl)ethyl]piperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(CCc3ccc(OC)cc3)CC2)s1 |
| InChI | InChI=1S/C19H26N2O3S2/c1-3-18-8-9-19(25-18)26(22,23)21-14-12-20(13-15-21)11-10-16-4-6-17(24-2)7-5-16/h4-9H,3,10-15H2,1-2H3 |
| InChIKey | OGGQOZGMWYHORY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |