C18H23FN2O2S2 — CID 110412116
1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(2-fluorophenyl)ethyl]piperazine (PubChem CID 110412116) has the molecular formula C18H23FN2O2S2 and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(2-fluorophenyl)ethyl]piperazine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(2-fluorophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 110412116 |
| Molecular Formula | C18H23FN2O2S2 |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(2-fluorophenyl)ethyl]piperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(CCc3ccccc3F)CC2)s1 |
| InChI | InChI=1S/C18H23FN2O2S2/c1-2-16-7-8-18(24-16)25(22,23)21-13-11-20(12-14-21)10-9-15-5-3-4-6-17(15)19/h3-8H,2,9-14H2,1H3 |
| InChIKey | QSAFBADMBWSJQF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |