C17H19FN2O4S2 — CID 47012540
2-[5-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]sulfonylthiophen-2-yl]acetic acid (PubChem CID 47012540) has the molecular formula C17H19FN2O4S2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[5-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]sulfonylthiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]sulfonylthiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 47012540 |
| Molecular Formula | C17H19FN2O4S2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[5-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]sulfonylthiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(S(=O)(=O)N2CCN(Cc3ccccc3F)CC2)s1 |
| InChI | InChI=1S/C17H19FN2O4S2/c18-15-4-2-1-3-13(15)12-19-7-9-20(10-8-19)26(23,24)17-6-5-14(25-17)11-16(21)22/h1-6H,7-12H2,(H,21,22) |
| InChIKey | JNESWXMBWBOZDU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |