C22H29N3O3S2 — CID 34347338
1-(4-benzylpiperazin-1-yl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethanone (PubChem CID 34347338) has the molecular formula C22H29N3O3S2 and a molecular weight of 447.63 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 34347338 |
| Molecular Formula | C22H29N3O3S2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethanone |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)s1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O3S2/c26-21(24-15-13-23(14-16-24)18-19-7-3-1-4-8-19)17-20-9-10-22(29-20)30(27,28)25-11-5-2-6-12-25/h1,3-4,7-10H,2,5-6,11-18H2 |
| InChIKey | RJFCUWIEGOMGDR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |