C15H20N2O6S2 — CID 119239114
4-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]morpholine-2-carboxylic acid (PubChem CID 119239114) has the molecular formula C15H20N2O6S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 119239114 |
| Molecular Formula | C15H20N2O6S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]morpholine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)Cc2ccc(S(=O)(=O)N3CCCC3)s2)CCO1 |
| InChI | InChI=1S/C15H20N2O6S2/c18-13(16-7-8-23-12(10-16)15(19)20)9-11-3-4-14(24-11)25(21,22)17-5-1-2-6-17/h3-4,12H,1-2,5-10H2,(H,19,20) |
| InChIKey | XZZFBSNTQFMWFZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |