C15H23N3O3S2 — CID 119379191
1-(3-aminopiperidin-1-yl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)ethanone (PubChem CID 119379191) has the molecular formula C15H23N3O3S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)ethanone.
| Compound Name | 1-(3-aminopiperidin-1-yl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 119379191 |
| Molecular Formula | C15H23N3O3S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)ethanone |
| SMILES | NC1CCCN(C(=O)Cc2ccc(S(=O)(=O)N3CCCC3)s2)C1 |
| InChI | InChI=1S/C15H23N3O3S2/c16-12-4-3-7-17(11-12)14(19)10-13-5-6-15(22-13)23(20,21)18-8-1-2-9-18/h5-6,12H,1-4,7-11,16H2 |
| InChIKey | CYOQBTVHTXMHBG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |