C17H26N2O3S2 — CID 112760227
1-(2-ethylpiperidin-1-yl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)ethanone (PubChem CID 112760227) has the molecular formula C17H26N2O3S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)ethanone.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 112760227 |
| Molecular Formula | C17H26N2O3S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)ethanone |
| SMILES | CCC1CCCCN1C(=O)Cc1ccc(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C17H26N2O3S2/c1-2-14-7-3-4-12-19(14)16(20)13-15-8-9-17(23-15)24(21,22)18-10-5-6-11-18/h8-9,14H,2-7,10-13H2,1H3 |
| InChIKey | QSFCUCMCWQZVSE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |