C16H24N4O2S2 — CID 90534071
1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine (PubChem CID 90534071) has the molecular formula C16H24N4O2S2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 90534071 |
| Molecular Formula | C16H24N4O2S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(CCn3ccnc3C)CC2)s1 |
| InChI | InChI=1S/C16H24N4O2S2/c1-3-15-4-5-16(23-15)24(21,22)20-12-9-18(10-13-20)8-11-19-7-6-17-14(19)2/h4-7H,3,8-13H2,1-2H3 |
| InChIKey | SIPCABINDJERPZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |