C17H23ClN4O2S — CID 90534079
1-(5-chloro-2-methylphenyl)sulfonyl-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine (PubChem CID 90534079) has the molecular formula C17H23ClN4O2S and a molecular weight of 382.92 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)sulfonyl-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine.
| Compound Name | 1-(5-chloro-2-methylphenyl)sulfonyl-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 90534079 |
| Molecular Formula | C17H23ClN4O2S |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)sulfonyl-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)N1CCN(CCn2ccnc2C)CC1 |
| InChI | InChI=1S/C17H23ClN4O2S/c1-14-3-4-16(18)13-17(14)25(23,24)22-11-8-20(9-12-22)7-10-21-6-5-19-15(21)2/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | NDBBLCHHOYQYSO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |