C19H27ClN4O2S — CID 90561427
1-(3-chloro-2-methylphenyl)sulfonyl-4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazine (PubChem CID 90561427) has the molecular formula C19H27ClN4O2S and a molecular weight of 410.97 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)sulfonyl-4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazine.
| Compound Name | 1-(3-chloro-2-methylphenyl)sulfonyl-4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 90561427 |
| Molecular Formula | C19H27ClN4O2S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)sulfonyl-4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazine |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCN(CCn2ccnc2C(C)C)CC1 |
| InChI | InChI=1S/C19H27ClN4O2S/c1-15(2)19-21-7-8-23(19)12-9-22-10-13-24(14-11-22)27(25,26)18-6-4-5-17(20)16(18)3/h4-8,15H,9-14H2,1-3H3 |
| InChIKey | MUOBTQBKRKWAJL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |