C22H29N5O2 — CID 90561293
2-[2-[4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 90561293) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-[2-[4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90561293 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 2-[2-[4-[2-(2-propan-2-ylimidazol-1-yl)ethyl]piperazin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)c1nccn1CCN1CCN(CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C22H29N5O2/c1-17(2)20-23-7-8-26(20)15-13-24-9-11-25(12-10-24)14-16-27-21(28)18-5-3-4-6-19(18)22(27)29/h3-8,17H,9-16H2,1-2H3 |
| InChIKey | QYXWKMINUGIRBR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|