C18H22N6O2S2 — CID 122338861
4-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-(2-methylimidazol-1-yl)pyrimidine (PubChem CID 122338861) has the molecular formula C18H22N6O2S2 and a molecular weight of 418.55 g/mol. Its IUPAC name is 4-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-(2-methylimidazol-1-yl)pyrimidine.
| Compound Name | 4-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-(2-methylimidazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 122338861 |
| Molecular Formula | C18H22N6O2S2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-(2-methylimidazol-1-yl)pyrimidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(c3cc(-n4ccnc4C)ncn3)CC2)s1 |
| InChI | InChI=1S/C18H22N6O2S2/c1-3-15-4-5-18(27-15)28(25,26)23-10-8-22(9-11-23)16-12-17(21-13-20-16)24-7-6-19-14(24)2/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | ZOCXXVKFVFWYMF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |