C15H20N6O2S — CID 122338868
4-(4-cyclopropylsulfonylpiperazin-1-yl)-6-(2-methylimidazol-1-yl)pyrimidine (PubChem CID 122338868) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-(4-cyclopropylsulfonylpiperazin-1-yl)-6-(2-methylimidazol-1-yl)pyrimidine.
| Compound Name | 4-(4-cyclopropylsulfonylpiperazin-1-yl)-6-(2-methylimidazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 122338868 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-(4-cyclopropylsulfonylpiperazin-1-yl)-6-(2-methylimidazol-1-yl)pyrimidine |
| SMILES | Cc1nccn1-c1cc(N2CCN(S(=O)(=O)C3CC3)CC2)ncn1 |
| InChI | InChI=1S/C15H20N6O2S/c1-12-16-4-5-21(12)15-10-14(17-11-18-15)19-6-8-20(9-7-19)24(22,23)13-2-3-13/h4-5,10-11,13H,2-3,6-9H2,1H3 |
| InChIKey | YVHPCPNUEDRBFP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |