C16H23N3O2S2 — CID 90494813
1-(5-ethylthiophen-2-yl)sulfonyl-4-[(2-methylimidazol-1-yl)methyl]piperidine (PubChem CID 90494813) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-[(2-methylimidazol-1-yl)methyl]piperidine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[(2-methylimidazol-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 90494813 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-[(2-methylimidazol-1-yl)methyl]piperidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(Cn3ccnc3C)CC2)s1 |
| InChI | InChI=1S/C16H23N3O2S2/c1-3-15-4-5-16(22-15)23(20,21)19-9-6-14(7-10-19)12-18-11-8-17-13(18)2/h4-5,8,11,14H,3,6-7,9-10,12H2,1-2H3 |
| InChIKey | GGPYLYOEBJSIPD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |